cas: 67929-86-6 — see every product listed under this CAS number, including other names
Methyl 5-methoxyindole-2-carboxylate, 98%, 98% (CAS 67929-86-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11732W-250mg |
| cas | 67929-86-6 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 208.40 Pln | |
| Chemat | 10g | 338.00 Pln | |
| Chemat | 25g | 654.80 Pln | |
| Chemat | 100g | 1950.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-methoxy-1H-indole-2-carboxylate (CAS 67929-86-6) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: methyl 5-methoxy-1H-indole-2-carboxylate. InChIKey: OXXJVMUTSUYQBR-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | methyl 5-methoxy-1H-indole-2-carboxylate |
| InChIKey | OXXJVMUTSUYQBR-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=C2)C(=O)OC |
Computed by PubChem (NCBI)