cas: 67929-86-6 — see every product listed under this CAS number, including other names
Methyl 5-methoxyindole-2-carboxylate, 98% (CAS 67929-86-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222014-1G |
| cas | 67929-86-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 5g | 221.81 Pln | |
| Fluorochem | 10g | 388.42 Pln | |
| Fluorochem | 25g | 862.21 Pln | |
| Fluorochem | 100g | 2580.36 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 5-methoxy-1H-indole-2-carboxylate (CAS 67929-86-6) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: methyl 5-methoxy-1H-indole-2-carboxylate. InChIKey: OXXJVMUTSUYQBR-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | methyl 5-methoxy-1H-indole-2-carboxylate |
| InChIKey | OXXJVMUTSUYQBR-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=C2)C(=O)OC |
Computed by PubChem (NCBI)