cas: 78155-75-6 — see every product listed under this CAS number, including other names
Methyl 5-nitro-1H-indazole-3-carboxylate, 95%, 95% (CAS 78155-75-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119NHQ-250mg |
| cas | 78155-75-6 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 438.80 Pln | |
| Chemat | 100mg | 208.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-nitro-1H-indazole-3-carboxylate (CAS 78155-75-6) is a chemical compound with the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. IUPAC name: methyl 5-nitro-1H-indazole-3-carboxylate. InChIKey: TUUGVBZYZYAHPC-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | methyl 5-nitro-1H-indazole-3-carboxylate |
| InChIKey | TUUGVBZYZYAHPC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NNC2=C1C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)