cas: 2304635-05-8 — see every product listed under this CAS number, including other names
Methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-4-carboxylate, 98%, 98% (CAS 2304635-05-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IKX8-100mg |
| cas | 2304635-05-8 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 434.00 Pln | |
| Chemat | 1g | 1034.00 Pln | |
| Chemat | 5g | 3774.80 Pln | |
| Chemat | 10g | 7302.80 Pln | |
| Chemat | 25g | 17853.20 Pln | |
| Chemat | 500mg | 712.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-4-carboxylate (CAS 2304635-05-8) is a chemical compound with the molecular formula C16H20BNO4 and a molecular weight of 301.1 g/mol. IUPAC name: methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-4-carboxylate. InChIKey: XGHMLVNOYJXFQB-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO4 |
|---|---|
| Molecular weight | 301.1 g/mol |
| IUPAC name | methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-4-carboxylate |
| InChIKey | XGHMLVNOYJXFQB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C3C=CNC3=C2)C(=O)OC |
Computed by PubChem (NCBI)