cas: 2304635-05-8 — see every product listed under this CAS number, including other names
Methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-4-carboxylate (CAS 2304635-05-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 500mg, 1g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | ESD63505-5g |
| cas | 2304635-05-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 5g | price on request | |
| Biosynth | 0,5g | price on request | |
| Fluorochem | 100mg | 445.69 Pln | |
| Fluorochem | 250mg | 914.28 Pln | |
| Fluorochem | 500mg | 1611.95 Pln | |
| Fluorochem | 1g | 2226.32 Pln | |
| Fluorochem | 5g | 5725.09 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
Methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-4-carboxylate (CAS 2304635-05-8) is a chemical compound with the molecular formula C16H20BNO4 and a molecular weight of 301.1 g/mol. IUPAC name: methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-4-carboxylate. InChIKey: XGHMLVNOYJXFQB-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO4 |
|---|---|
| Molecular weight | 301.1 g/mol |
| IUPAC name | methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-4-carboxylate |
| InChIKey | XGHMLVNOYJXFQB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C3C=CNC3=C2)C(=O)OC |
Computed by PubChem (NCBI)