cas: 1220418-81-4 — see every product listed under this CAS number, including other names
Methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-3-carboxylate, 96%, 96% (CAS 1220418-81-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110WV7-100mg |
| cas | 1220418-81-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 784.40 Pln | |
| Chemat | 250mg | 1509.20 Pln | |
| Chemat | 1g | 3165.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-3-carboxylate (CAS 1220418-81-4) is a chemical compound with the molecular formula C17H20BNO4 and a molecular weight of 313.2 g/mol. IUPAC name: methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-3-carboxylate. InChIKey: ZCAZNFZFHJVJGE-UHFFFAOYSA-N.
| Molecular formula | C17H20BNO4 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-3-carboxylate |
| InChIKey | ZCAZNFZFHJVJGE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CC(=CN=C3C=C2)C(=O)OC |
Computed by PubChem (NCBI)