Products 2640496-82-6
CAS 2640496-82-6 is the registry number for Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-6-carboxylate, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-6-carboxylate (CAS 2640496-82-6) is a chemical compound with the molecular formula C17H20BNO4 and a molecular weight of 313.2 g/mol. IUPAC name: methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-6-carboxylate. InChIKey: IKCKSRUNJHHPIM-UHFFFAOYSA-N.
| Molecular formula | C17H20BNO4 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-6-carboxylate |
| InChIKey | IKCKSRUNJHHPIM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=CC(=C3)C(=O)OC)N=C2 |
Computed by PubChem (NCBI)