CAS 3080511-03-8 is the registry number for Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-2-carboxylate, 98%. Offered by: Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-2-carboxylate (CAS 3080511-03-8) is a chemical compound with the molecular formula C17H20BNO4 and a molecular weight of 313.2 g/mol. IUPAC name: methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-2-carboxylate. InChIKey: QDSRNHNVPRJZGV-UHFFFAOYSA-N.
| Molecular formula | C17H20BNO4 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-2-carboxylate |
| InChIKey | QDSRNHNVPRJZGV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CC(=NC3=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)