Products 1809716-47-9
CAS 1809716-47-9 is the registry number for Methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-8-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
Methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-8-carboxylate (CAS 1809716-47-9) is a chemical compound with the molecular formula C17H20BNO4 and a molecular weight of 313.2 g/mol. IUPAC name: methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-8-carboxylate. InChIKey: UWKIHUXDOHXCGI-UHFFFAOYSA-N.
| Molecular formula | C17H20BNO4 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-8-carboxylate |
| InChIKey | UWKIHUXDOHXCGI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C(=C2)C(=O)OC)N=CC=C3 |
Computed by PubChem (NCBI)