cas: 73907-98-9 — see every product listed under this CAS number, including other names
Methyl 6-amino-1H-indazole-7-carboxylate 98% (CAS 73907-98-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A138328-100mg |
| cas | 73907-98-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 987.81 Pln | |
| Ambeed | 5g | 4642.38 Pln | |
| Ambeed | 10g | 7384.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A138328 |
Methyl 6-amino-1H-indazole-7-carboxylate (CAS 73907-98-9) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: methyl 6-amino-1H-indazole-7-carboxylate. InChIKey: QHEAFURFKCHXJW-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | methyl 6-amino-1H-indazole-7-carboxylate |
| InChIKey | QHEAFURFKCHXJW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC2=C1NN=C2)N |
Computed by PubChem (NCBI)