Methyl 6-amino-2-bromo-3-methoxybenzoate, 95%
cas: 1340366-76-8 — see every product listed under this CAS number, including other names
Methyl 6-amino-2-bromo-3-methoxybenzoate, 95% (CAS 1340366-76-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1090412-250mg |
| cas | 1340366-76-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 954.44 Pln | |
| Ambeed | 1g | 2256.06 Pln | |
| BLDpharm | 50mg | 458.75 Pln | |
| BLDpharm | 100mg | 669.79 Pln | |
| BLDpharm | 250mg | 1025.22 Pln | |
| BLDpharm | 1g | 2424.73 Pln | |
| Chemat | 50mg | 741.20 Pln | |
| Chemat | 100mg | 1120.40 Pln | |
| Chemat | 250mg | 1754.00 Pln | |
| Fluorochem | 50mg | 1372.45 Pln | |
| Fluorochem | 100mg | 2075.33 Pln | |
| Fluorochem | 250mg | 3236.38 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 6-amino-2-bromo-3-methoxybenzoate (CAS 1340366-76-8) is a chemical compound with the molecular formula C9H10BrNO3 and a molecular weight of 260.08 g/mol. IUPAC name: methyl 6-amino-2-bromo-3-methoxybenzoate. InChIKey: JMHBOGOGOYQIGX-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO3 |
|---|---|
| Molecular weight | 260.08 g/mol |
| IUPAC name | methyl 6-amino-2-bromo-3-methoxybenzoate |
| InChIKey | JMHBOGOGOYQIGX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)N)C(=O)OC)Br |
Computed by PubChem (NCBI)