cas: 1346702-53-1 — see every product listed under this CAS number, including other names
Methyl 6-bromo-2-isopropyl-2H-indazole-4-carboxylate, 97%, 97% (CAS 1346702-53-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110YO7-100mg |
| cas | 1346702-53-1 |
| size | 100mg |
| availability | 26.672g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 500mg | 285.20 Pln | |
| Chemat | 1g | 400.40 Pln | |
| Chemat | 5g | 1072.40 Pln | |
| Chemat | 10g | 1739.60 Pln | |
| Chemat | 25g | 3419.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-bromo-2-propan-2-ylindazole-4-carboxylate (CAS 1346702-53-1) is a chemical compound with the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. IUPAC name: methyl 6-bromo-2-propan-2-ylindazole-4-carboxylate. InChIKey: PIVQDVUHTABDHA-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O2 |
|---|---|
| Molecular weight | 297.15 g/mol |
| IUPAC name | methyl 6-bromo-2-propan-2-ylindazole-4-carboxylate |
| InChIKey | PIVQDVUHTABDHA-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C2C(=CC(=CC2=N1)Br)C(=O)OC |
Computed by PubChem (NCBI)