CAS 1437794-87-0 is the registry number for Ethyl 7-bromo-1-ethyl-1,3-benzodiazole-5-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Ethyl 7-bromo-1-ethylbenzimidazole-5-carboxylate (CAS 1437794-87-0) is a chemical compound with the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. IUPAC name: ethyl 7-bromo-1-ethylbenzimidazole-5-carboxylate. InChIKey: HGJXJXOFJHGZSY-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O2 |
|---|---|
| Molecular weight | 297.15 g/mol |
| IUPAC name | ethyl 7-bromo-1-ethylbenzimidazole-5-carboxylate |
| InChIKey | HGJXJXOFJHGZSY-UHFFFAOYSA-N |
| SMILES | CCN1C=NC2=C1C(=CC(=C2)C(=O)OCC)Br |
Computed by PubChem (NCBI)