Methyl 6-bromo-3-chloropicolinate, 97%
cas: 350602-14-1 — see every product listed under this CAS number, including other names
Methyl 6-bromo-3-chloropicolinate, 97% (CAS 350602-14-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F546105-100MG |
| cas | 350602-14-1 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 482.14 Pln | |
| Fluorochem | 250mg | 591.48 Pln | |
| Fluorochem | 1g | 1388.07 Pln | |
| Fluorochem | 5g | 3965.29 Pln | |
| Fluorochem | 10g | 6953.82 Pln | |
| Fluorochem | 25g | 17299.13 Pln | |
| Ambeed | 100mg | 492.75 Pln | |
| Ambeed | 250mg | 576.19 Pln | |
| Ambeed | 1g | 1338.25 Pln | |
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 250mg | 501.20 Pln | |
| Chemat | 1g | 1302.80 Pln | |
| Chemat | 5g | 3645.20 Pln | |
| BLDpharm | 250mg | 569.82 Pln | |
| BLDpharm | 1g | 1552.81 Pln | |
| BLDpharm | 5g | 4529.54 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Methyl 6-bromo-3-chloropyridine-2-carboxylate (CAS 350602-14-1) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: methyl 6-bromo-3-chloropyridine-2-carboxylate. InChIKey: PBXRVNDIWMTXMO-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | methyl 6-bromo-3-chloropyridine-2-carboxylate |
| InChIKey | PBXRVNDIWMTXMO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=N1)Br)Cl |
Computed by PubChem (NCBI)