cas: 885280-04-6 — see every product listed under this CAS number, including other names
Methyl 6-fluoro-1H-benzo[d]imidazole-2-carboxylate 95% (CAS 885280-04-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A546818-100mg |
| cas | 885280-04-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 987.81 Pln | |
| Ambeed | 1g | 1799.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A546818 |
Methyl 6-fluoro-1H-benzimidazole-2-carboxylate (CAS 885280-04-6) is a chemical compound with the molecular formula C9H7FN2O2 and a molecular weight of 194.16 g/mol. IUPAC name: methyl 6-fluoro-1H-benzimidazole-2-carboxylate. InChIKey: KRUUHHRJIZQRSR-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O2 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | methyl 6-fluoro-1H-benzimidazole-2-carboxylate |
| InChIKey | KRUUHHRJIZQRSR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C(N1)C=C(C=C2)F |
Computed by PubChem (NCBI)