Methyl 7-bromo-4-fluoro-2,3-dihydrobenzofuran-5-carboxylate, 97%
cas: 2253108-16-4 — see every product listed under this CAS number, including other names
Methyl 7-bromo-4-fluoro-2,3-dihydrobenzofuran-5-carboxylate, 97% (CAS 2253108-16-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A1225186-1g |
| cas | 2253108-16-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 14880.25 Pln | |
| AmBeed | 5g | 45431.68 Pln | |
| Fluorochem | 100mg | 2491.85 Pln | |
| Fluorochem | 250mg | 4069.42 Pln | |
| Fluorochem | 500mg | 6584.16 Pln | |
| Fluorochem | 1g | 9838.22 Pln | |
| Fluorochem | 5g | 29373.01 Pln | |
| Chemat | 100mg | 1062.80 Pln | |
| Chemat | 250mg | 1725.20 Pln | |
| Chemat | 500mg | 2834.00 Pln | |
| Chemat | 1g | 4221.20 Pln | |
| Chemat | 5g | 12534.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 7-bromo-4-fluoro-2,3-dihydro-1-benzofuran-5-carboxylate (CAS 2253108-16-4) is a chemical compound with the molecular formula C10H8BrFO3 and a molecular weight of 275.07 g/mol. IUPAC name: methyl 7-bromo-4-fluoro-2,3-dihydro-1-benzofuran-5-carboxylate. InChIKey: HQOWHSGDCLLDTB-UHFFFAOYSA-N.
| Molecular formula | C10H8BrFO3 |
|---|---|
| Molecular weight | 275.07 g/mol |
| IUPAC name | methyl 7-bromo-4-fluoro-2,3-dihydro-1-benzofuran-5-carboxylate |
| InChIKey | HQOWHSGDCLLDTB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C2C(=C1F)CCO2)Br |
Computed by PubChem (NCBI)