Products 2666375-77-3

CAS 2666375-77-3 is the registry number for 3-(2-Bromo-6-fluoro-3-methylphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(2-bromo-6-fluoro-3-methylphenyl)-2-oxopropanoic acid (CAS 2666375-77-3) is a chemical compound with the molecular formula C10H8BrFO3 and a molecular weight of 275.07 g/mol. IUPAC name: 3-(2-bromo-6-fluoro-3-methylphenyl)-2-oxopropanoic acid. InChIKey: ODVFTMFXDFDURS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8BrFO3
Molecular weight275.07 g/mol
IUPAC name3-(2-bromo-6-fluoro-3-methylphenyl)-2-oxopropanoic acid
InChIKeyODVFTMFXDFDURS-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)F)CC(=O)C(=O)O)Br

Computed by PubChem (NCBI)