Products 1824634-11-8

CAS 1824634-11-8 is the registry number for 6-Bromo-7-fluorochromane-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-bromo-7-fluoro-3,4-dihydro-2H-chromene-4-carboxylic acid (CAS 1824634-11-8) is a chemical compound with the molecular formula C10H8BrFO3 and a molecular weight of 275.07 g/mol. IUPAC name: 6-bromo-7-fluoro-3,4-dihydro-2H-chromene-4-carboxylic acid. InChIKey: NDBMJXQZRBBCSS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8BrFO3
Molecular weight275.07 g/mol
IUPAC name6-bromo-7-fluoro-3,4-dihydro-2H-chromene-4-carboxylic acid
InChIKeyNDBMJXQZRBBCSS-UHFFFAOYSA-N
SMILESC1COC2=CC(=C(C=C2C1C(=O)O)Br)F

Computed by PubChem (NCBI)