Products 49780-08-7

CAS 49780-08-7 is the registry number for 3-Bromo-4-(4-fluorophenyl)-4-oxobutanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

3-bromo-4-(4-fluorophenyl)-4-oxobutanoic acid (CAS 49780-08-7) is a chemical compound with the molecular formula C10H8BrFO3 and a molecular weight of 275.07 g/mol. IUPAC name: 3-bromo-4-(4-fluorophenyl)-4-oxobutanoic acid. InChIKey: CAZGDYWJCWEYTI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8BrFO3
Molecular weight275.07 g/mol
IUPAC name3-bromo-4-(4-fluorophenyl)-4-oxobutanoic acid
InChIKeyCAZGDYWJCWEYTI-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)C(CC(=O)O)Br)F

Computed by PubChem (NCBI)