CAS 82684-06-8 appears in our catalog under these names: Methyl carnosate/ 98.47% (existing batch purity), Methyl carnosate, Methyl carnosate, Methyl carnosate, 97.62%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 100mg, 25mg, 5mg, 50mg, 100 mg, 10mM/1mL.
Methyl (4aR,10aS)-5,6-dihydroxy-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylate (CAS 82684-06-8) is a chemical compound with the molecular formula C21H30O4 and a molecular weight of 346.5 g/mol. IUPAC name: methyl (4aR,10aS)-5,6-dihydroxy-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylate. InChIKey: IIJLVJMZYPZQLW-YCRPNKLZSA-N.
| Molecular formula | C21H30O4 |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | methyl (4aR,10aS)-5,6-dihydroxy-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylate |
| InChIKey | IIJLVJMZYPZQLW-YCRPNKLZSA-N |
| SMILES | CC(C)C1=C(C(=C2C(=C1)CC[C@@H]3[C@@]2(CCCC3(C)C)C(=O)OC)O)O |
Computed by PubChem (NCBI)