cas: 53951-84-1 — see every product listed under this CAS number, including other names
Methyl quinoline-3-carboxylate, 97% (CAS 53951-84-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F067045-250MG |
| cas | 53951-84-1 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 117.68 Pln | |
| Fluorochem | 1g | 180.16 Pln | |
| Fluorochem | 5g | 643.54 Pln | |
| Fluorochem | 10g | 1216.26 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 626.25 Pln | |
| Ambeed | 10g | 1176.94 Pln | |
| Ambeed | 25g | 2295.00 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Methyl quinoline-3-carboxylate (CAS 53951-84-1) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: methyl quinoline-3-carboxylate. InChIKey: CWRATHCADZOYAT-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | methyl quinoline-3-carboxylate |
| InChIKey | CWRATHCADZOYAT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CC=CC=C2N=C1 |
Computed by PubChem (NCBI)