Products 73292-93-0
CAS 73292-93-0 appears in our catalog under these names: Micromarin F/ 99.76% (existing batch purity), Micromarin F. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 5 mg.
8-[(E)-4-hydroxy-3-methylbut-2-enyl]-7-methoxychromen-2-one (CAS 73292-93-0) is a chemical compound with the molecular formula C15H16O4 and a molecular weight of 260.28 g/mol. IUPAC name: 8-[(E)-4-hydroxy-3-methylbut-2-enyl]-7-methoxychromen-2-one. InChIKey: NYBDJZVNEBTWCZ-XCVCLJGOSA-N.
| Molecular formula | C15H16O4 |
|---|---|
| Molecular weight | 260.28 g/mol |
| IUPAC name | 8-[(E)-4-hydroxy-3-methylbut-2-enyl]-7-methoxychromen-2-one |
| InChIKey | NYBDJZVNEBTWCZ-XCVCLJGOSA-N |
| SMILES | C/C(=C\CC1=C(C=CC2=C1OC(=O)C=C2)OC)/CO |
Computed by PubChem (NCBI)