Products 91753-07-0
CAS 91753-07-0 appears in our catalog under these names: Mitoquidone/ 99.86% (existing batch purity), Mitoquidone. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
11-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1,4,6,8,12,15,17,19-octaene-14,21-dione (CAS 91753-07-0) is a chemical compound with the molecular formula C20H13NO2 and a molecular weight of 299.3 g/mol. IUPAC name: 11-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1,4,6,8,12,15,17,19-octaene-14,21-dione. InChIKey: BFRVNBMAWXNICS-UHFFFAOYSA-N.
| Molecular formula | C20H13NO2 |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | 11-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1,4,6,8,12,15,17,19-octaene-14,21-dione |
| InChIKey | BFRVNBMAWXNICS-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2CN3C1=C4C(=C3)C(=O)C5=CC=CC=C5C4=O |
Computed by PubChem (NCBI)