cas: 1666-17-7 — see every product listed under this CAS number, including other names
N'-Benzylidene-4-methylbenzenesulfonohydrazide, 95% (CAS 1666-17-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F241591-1G |
| cas | 1666-17-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 221.81 Pln | |
| Fluorochem | 10g | 388.42 Pln | |
| Fluorochem | 25g | 695.61 Pln | |
| Fluorochem | 100g | 2611.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
N-[(E)-benzylideneamino]-4-methylbenzenesulfonamide (CAS 1666-17-7) is a chemical compound with the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. IUPAC name: N-[(E)-benzylideneamino]-4-methylbenzenesulfonamide. InChIKey: FZFLTDNAHASQQC-RVDMUPIBSA-N.
| Molecular formula | C14H14N2O2S |
|---|---|
| Molecular weight | 274.34 g/mol |
| IUPAC name | N-[(E)-benzylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | FZFLTDNAHASQQC-RVDMUPIBSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)