cas: 158747-10-5 — see every product listed under this CAS number, including other names
N,3,3-Trimethyl-1,5-dioxaspiro[5.5]undecan-9-amine hydrochloride 98% (CAS 158747-10-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A455922-1g |
| cas | 158747-10-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1010.06 Pln | |
| Ambeed | 25g | 3997.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A455922 |
N,3,3-trimethyl-1,5-dioxaspiro[5.5]undecan-9-amine;hydrochloride (CAS 158747-10-5) is a chemical compound with the molecular formula C12H24ClNO2 and a molecular weight of 249.78 g/mol. IUPAC name: N,3,3-trimethyl-1,5-dioxaspiro[5.5]undecan-9-amine;hydrochloride. InChIKey: SUTDEUGEHVLMEF-UHFFFAOYSA-N.
| Molecular formula | C12H24ClNO2 |
|---|---|
| Molecular weight | 249.78 g/mol |
| IUPAC name | N,3,3-trimethyl-1,5-dioxaspiro[5.5]undecan-9-amine;hydrochloride |
| InChIKey | SUTDEUGEHVLMEF-UHFFFAOYSA-N |
| SMILES | CC1(COC2(CCC(CC2)NC)OC1)C.Cl |
Computed by PubChem (NCBI)