cas: 56222-36-7 — see every product listed under this CAS number, including other names
N,N'-(Ethane-1,2-diylidene)bis(2,4,6-trimethylaniline), >98.0%(GC)(N) (CAS 56222-36-7) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | E1383-200MG |
| cas | 56222-36-7 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 167.52 Pln | |
| TCI | 1g | 487.14 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(N) |
N,N'-bis(2,4,6-trimethylphenyl)ethane-1,2-diimine (CAS 56222-36-7) is a chemical compound with the molecular formula C20H24N2 and a molecular weight of 292.4 g/mol. IUPAC name: N,N'-bis(2,4,6-trimethylphenyl)ethane-1,2-diimine. InChIKey: YVKAJRYLHIECOK-UHFFFAOYSA-N.
| Molecular formula | C20H24N2 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | N,N'-bis(2,4,6-trimethylphenyl)ethane-1,2-diimine |
| InChIKey | YVKAJRYLHIECOK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)N=CC=NC2=C(C=C(C=C2C)C)C)C |
Computed by PubChem (NCBI)