cas: 56222-36-7 — see every product listed under this CAS number, including other names
N,N'-Bis(2,4,6-trimethylphenyl)ethane-1,2-diimine, 98.0%, 98.0% (CAS 56222-36-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 200mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DLT8-1g |
| cas | 56222-36-7 |
| size | 1g |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 592.40 Pln | |
| Chemat | 5g | 2392.40 Pln | |
| Chemat | 200mg | 194.00 Pln |
| purity | 98.0% |
|---|---|
| delivery time | 3 weeks |
N,N'-bis(2,4,6-trimethylphenyl)ethane-1,2-diimine (CAS 56222-36-7) is a chemical compound with the molecular formula C20H24N2 and a molecular weight of 292.4 g/mol. IUPAC name: N,N'-bis(2,4,6-trimethylphenyl)ethane-1,2-diimine. InChIKey: YVKAJRYLHIECOK-UHFFFAOYSA-N.
| Molecular formula | C20H24N2 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | N,N'-bis(2,4,6-trimethylphenyl)ethane-1,2-diimine |
| InChIKey | YVKAJRYLHIECOK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)N=CC=NC2=C(C=C(C=C2C)C)C)C |
Computed by PubChem (NCBI)