cas: 1011731-99-9 — see every product listed under this CAS number, including other names
N,N,2-Trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide 98% (CAS 1011731-99-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1161673-100mg |
| cas | 1011731-99-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1065.69 Pln | |
| Ambeed | 10g | 1744.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1161673 |
N,N,2-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1011731-99-9) is a chemical compound with the molecular formula C16H24BNO3 and a molecular weight of 289.2 g/mol. IUPAC name: N,N,2-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: CCVQRQAYAOUDGP-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO3 |
|---|---|
| Molecular weight | 289.2 g/mol |
| IUPAC name | N,N,2-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | CCVQRQAYAOUDGP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)N(C)C)C |
Computed by PubChem (NCBI)