cas: 7146-67-0 — see every product listed under this CAS number, including other names
N,N-Bis(2-hydroxyethyl)-4-methylbenzenesulfonamide, 98%, 98% (CAS 7146-67-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SHU-5g |
| cas | 7146-67-0 |
| size | 5g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 150.80 Pln | |
| Chemat | 25g | 419.60 Pln | |
| Chemat | 100g | 1245.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N,N-bis(2-hydroxyethyl)-4-methylbenzenesulfonamide (CAS 7146-67-0) is a chemical compound with the molecular formula C11H17NO4S and a molecular weight of 259.32 g/mol. IUPAC name: N,N-bis(2-hydroxyethyl)-4-methylbenzenesulfonamide. InChIKey: NHFJDXPINIIUQG-UHFFFAOYSA-N.
| Molecular formula | C11H17NO4S |
|---|---|
| Molecular weight | 259.32 g/mol |
| IUPAC name | N,N-bis(2-hydroxyethyl)-4-methylbenzenesulfonamide |
| InChIKey | NHFJDXPINIIUQG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(CCO)CCO |
Computed by PubChem (NCBI)