cas: 14417-01-7 — see every product listed under this CAS number, including other names
N,N-DIMETHYLBENZENESULFONAMIDE, 98% (CAS 14417-01-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386878-1G |
| cas | 14417-01-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 341.56 Pln | |
| Fluorochem | 10g | 622.72 Pln | |
| Fluorochem | 25g | 1185.02 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
N,N-dimethylbenzenesulfonamide (CAS 14417-01-7) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: N,N-dimethylbenzenesulfonamide. InChIKey: BVSPJPNNLDIUFE-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | N,N-dimethylbenzenesulfonamide |
| InChIKey | BVSPJPNNLDIUFE-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)