cas: 14417-01-7 — see every product listed under this CAS number, including other names
N,N-Dimethylbenzenesulfonamide, 98%, 98% (CAS 14417-01-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112J3B-100mg |
| cas | 14417-01-7 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 294.80 Pln | |
| Chemat | 25g | 861.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N,N-dimethylbenzenesulfonamide (CAS 14417-01-7) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: N,N-dimethylbenzenesulfonamide. InChIKey: BVSPJPNNLDIUFE-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | N,N-dimethylbenzenesulfonamide |
| InChIKey | BVSPJPNNLDIUFE-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)