N,N-Dibenzylacrylamide, 97%
cas: 57625-28-2 — see every product listed under this CAS number, including other names
N,N-Dibenzylacrylamide, 97% (CAS 57625-28-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A415053-250mg |
| cas | 57625-28-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 620.69 Pln | |
| Ambeed | 1g | 1544.06 Pln | |
| BLDpharm | 100mg | 392.11 Pln | |
| BLDpharm | 250mg | 608.70 Pln | |
| BLDpharm | 1g | 1519.49 Pln | |
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Fluorochem | 100mg | 508.17 Pln | |
| Fluorochem | 250mg | 804.94 Pln | |
| Fluorochem | 1g | 2028.47 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
N,N-dibenzylprop-2-enamide (CAS 57625-28-2) is a chemical compound with the molecular formula C17H17NO and a molecular weight of 251.32 g/mol. IUPAC name: N,N-dibenzylprop-2-enamide. InChIKey: MIVGZOMJVVQBAO-UHFFFAOYSA-N.
| Molecular formula | C17H17NO |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | N,N-dibenzylprop-2-enamide |
| InChIKey | MIVGZOMJVVQBAO-UHFFFAOYSA-N |
| SMILES | C=CC(=O)N(CC1=CC=CC=C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)