Products 1038924-61-6
CAS 1038924-61-6 appears in our catalog under these names: (S)-5-[(Biphenyl-4-yl)methyl]pyrrolidin-2-one, 95%, (S)-5-((1,1'-Biphenyl)-4-ylmethyl)pyrrolidin-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 5000mg, 1000mg.
(5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one (CAS 1038924-61-6) is a chemical compound with the molecular formula C17H17NO and a molecular weight of 251.32 g/mol. IUPAC name: (5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one. InChIKey: SOBIWLIICMUXJK-INIZCTEOSA-N.
| Molecular formula | C17H17NO |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | (5S)-5-[(4-phenylphenyl)methyl]pyrrolidin-2-one |
| InChIKey | SOBIWLIICMUXJK-INIZCTEOSA-N |
| SMILES | C1CC(=O)N[C@@H]1CC2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)