CAS 360045-08-5 is the registry number for 1-(3,5-Dimethylphenyl)-5-methoxyindole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1-(3,5-dimethylphenyl)-5-methoxyindole (CAS 360045-08-5) is a chemical compound with the molecular formula C17H17NO and a molecular weight of 251.32 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)-5-methoxyindole. InChIKey: ZYLBAMYEXCOHTN-UHFFFAOYSA-N.
| Molecular formula | C17H17NO |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | 1-(3,5-dimethylphenyl)-5-methoxyindole |
| InChIKey | ZYLBAMYEXCOHTN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N2C=CC3=C2C=CC(=C3)OC)C |
Computed by PubChem (NCBI)