CAS 98681-35-7 is the registry number for N-(2,5-Dimethylphenyl)cinnamamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-N-(2,5-dimethylphenyl)-3-phenylprop-2-enamide (CAS 98681-35-7) is a chemical compound with the molecular formula C17H17NO and a molecular weight of 251.32 g/mol. IUPAC name: (E)-N-(2,5-dimethylphenyl)-3-phenylprop-2-enamide. InChIKey: SUUINTFSMKCFPR-ZHACJKMWSA-N.
| Molecular formula | C17H17NO |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | (E)-N-(2,5-dimethylphenyl)-3-phenylprop-2-enamide |
| InChIKey | SUUINTFSMKCFPR-ZHACJKMWSA-N |
| SMILES | CC1=CC(=C(C=C1)C)NC(=O)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)