N,N-Dibenzylaniline, 98%, 98%
cas: 91-73-6 — see every product listed under this CAS number, including other names
N,N-Dibenzylaniline, 98%, 98% (CAS 91-73-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 15g, 200g, 300g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SIJ-5g |
| cas | 91-73-6 |
| size | 5g |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 414.80 Pln | |
| Chemat | 500g | 1723.20 Pln | |
| Chemat | 15g | 136.40 Pln | |
| Chemat | 200g | 731.60 Pln | |
| Chemat | 300g | 1053.20 Pln | |
| Chemat | 400g | 1370.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N,N-dibenzylaniline (CAS 91-73-6) is a chemical compound with the molecular formula C20H19N and a molecular weight of 273.4 g/mol. IUPAC name: N,N-dibenzylaniline. InChIKey: ISGXOWLMGOPVPB-UHFFFAOYSA-N.
| Molecular formula | C20H19N |
|---|---|
| Molecular weight | 273.4 g/mol |
| IUPAC name | N,N-dibenzylaniline |
| InChIKey | ISGXOWLMGOPVPB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)