cas: 77925-51-0 — see every product listed under this CAS number, including other names
N,N-Diethyl-2-nitrobenzenesulfonamide (CAS 77925-51-0) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1167IQ-1g |
| cas | 77925-51-0 |
| size | 1g |
| availability | 19.47g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1000.40 Pln | |
| Fluorochem | 1g | 1627.57 Pln |
| delivery time | 3 weeks |
|---|
N,N-diethyl-2-nitrobenzenesulfonamide (CAS 77925-51-0) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: N,N-diethyl-2-nitrobenzenesulfonamide. InChIKey: TVZZRXKFWHHNMB-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | N,N-diethyl-2-nitrobenzenesulfonamide |
| InChIKey | TVZZRXKFWHHNMB-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)