cas: 6335-26-8 — see every product listed under this CAS number, including other names
N,N-Diethyl-3-nitrobenzenesulfonamide, 95%, 95% (CAS 6335-26-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SJ4-1g |
| cas | 6335-26-8 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1269.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N,N-diethyl-3-nitrobenzenesulfonamide (CAS 6335-26-8) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: N,N-diethyl-3-nitrobenzenesulfonamide. InChIKey: HOGKOBQIINJDJM-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | N,N-diethyl-3-nitrobenzenesulfonamide |
| InChIKey | HOGKOBQIINJDJM-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=CC(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)