cas: 58287-77-7 — see every product listed under this CAS number, including other names
N,N-Diethyl-4-formylbenzamide, 95%, 95% (CAS 58287-77-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EJXK-100mg |
| cas | 58287-77-7 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 640.40 Pln | |
| Chemat | 5g | 1821.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N,N-diethyl-4-formylbenzamide (CAS 58287-77-7) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: N,N-diethyl-4-formylbenzamide. InChIKey: OTGRTWQLBHAZFG-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | N,N-diethyl-4-formylbenzamide |
| InChIKey | OTGRTWQLBHAZFG-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)