CAS 2216-15-1 appears in our catalog under these names: N,N-Diethyl-4-nitroaniline, 98%, N,N-Diethyl-4-nitroaniline, 95-<97%, N,N-Diethyl-4-nitroaniline, ≥97-<99%, N,N-Diethyl-4-nitroaniline, >95% (HPLC). Offered by: Combi-blocks, Hoffman Fine Chemicals, TRC. Available pack sizes: 25g, 100g, 1g, 5g, 50g, 200g, 300g, 400g.
N,N-diethyl-4-nitroaniline (CAS 2216-15-1) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: N,N-diethyl-4-nitroaniline. InChIKey: CFPIZMWTMRWZRO-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | N,N-diethyl-4-nitroaniline |
| InChIKey | CFPIZMWTMRWZRO-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)