CAS 1338990-46-7 appears in our catalog under these names: tert-Butyl 2-aminoisonicotinate, 95%, tert-Butyl 2-aminoisonicotinate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g.
Tert-butyl 2-aminopyridine-4-carboxylate (CAS 1338990-46-7) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: tert-butyl 2-aminopyridine-4-carboxylate. InChIKey: LUEKUBTVMCUQNV-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | tert-butyl 2-aminopyridine-4-carboxylate |
| InChIKey | LUEKUBTVMCUQNV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=NC=C1)N |
Computed by PubChem (NCBI)