CAS 3663-22-7 appears in our catalog under these names: 4-Butyl-2-nitroaniline, 95%, 4-Butyl-2-nitroaniline, 96%, 96%, 4-Butyl-2-nitroaniline, 85%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100g, 25g.
4-butyl-2-nitroaniline (CAS 3663-22-7) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 4-butyl-2-nitroaniline. InChIKey: RAKSJFYIAHRHCH-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 4-butyl-2-nitroaniline |
| InChIKey | RAKSJFYIAHRHCH-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC(=C(C=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)