CAS 121649-61-4 appears in our catalog under these names: Isopropyl 3,4-diaminobenzoate, 95%, Isopropyl 3,4–diaminobenzoate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 25g, 250mg, 10g, 1g, 100mg.
Propan-2-yl 3,4-diaminobenzoate (CAS 121649-61-4) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: propan-2-yl 3,4-diaminobenzoate. InChIKey: CRICWBSRSIVCOV-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | propan-2-yl 3,4-diaminobenzoate |
| InChIKey | CRICWBSRSIVCOV-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC(=C(C=C1)N)N |
Computed by PubChem (NCBI)