cas: 5167-17-9 — see every product listed under this CAS number, including other names
N,N-Diethyl-9H-purin-2-amine, 97%, 97% (CAS 5167-17-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E1NV-100mg |
| cas | 5167-17-9 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 554.00 Pln | |
| Chemat | 250mg | 880.40 Pln | |
| Chemat | 500mg | 1427.60 Pln | |
| Chemat | 1g | 2114.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N,N-diethyl-7H-purin-2-amine (CAS 5167-17-9) is a chemical compound with the molecular formula C9H13N5 and a molecular weight of 191.23 g/mol. IUPAC name: N,N-diethyl-7H-purin-2-amine. InChIKey: AEKLNDWDOJGCQM-UHFFFAOYSA-N.
| Molecular formula | C9H13N5 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | N,N-diethyl-7H-purin-2-amine |
| InChIKey | AEKLNDWDOJGCQM-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=NC=C2C(=N1)N=CN2 |
Computed by PubChem (NCBI)