cas: 5167-17-9 — see every product listed under this CAS number, including other names
N,N-Diethyl-9H-purin-2-amine, 97% (CAS 5167-17-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A677627-10g |
| cas | 5167-17-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 18519.34 Pln | |
| AmBeed | 5g | 11137.00 Pln | |
| AmBeed | 1g | 3761.17 Pln | |
| Fluorochem | 100mg | 888.25 Pln | |
| Fluorochem | 250mg | 1434.93 Pln | |
| Fluorochem | 500mg | 2340.86 Pln | |
| Fluorochem | 1g | 3475.88 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
N,N-diethyl-7H-purin-2-amine (CAS 5167-17-9) is a chemical compound with the molecular formula C9H13N5 and a molecular weight of 191.23 g/mol. IUPAC name: N,N-diethyl-7H-purin-2-amine. InChIKey: AEKLNDWDOJGCQM-UHFFFAOYSA-N.
| Molecular formula | C9H13N5 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | N,N-diethyl-7H-purin-2-amine |
| InChIKey | AEKLNDWDOJGCQM-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=NC=C2C(=N1)N=CN2 |
Computed by PubChem (NCBI)