CAS 69261-01-4 appears in our catalog under these names: N,N–Dimethyl 4–fluoro–2–nitroaniline, N,N-Dimethyl-4-fluoro-2-nitroaniline, 98%, N,N-Dimethyl 4-fluoro-2-nitroaniline, 99%. Offered by: GLPBio, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 10g, 100g.
4-fluoro-N,N-dimethyl-2-nitroaniline (CAS 69261-01-4) is a chemical compound with the molecular formula C8H9FN2O2 and a molecular weight of 184.17 g/mol. IUPAC name: 4-fluoro-N,N-dimethyl-2-nitroaniline. InChIKey: RGCUVPLVTHHXMT-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O2 |
|---|---|
| Molecular weight | 184.17 g/mol |
| IUPAC name | 4-fluoro-N,N-dimethyl-2-nitroaniline |
| InChIKey | RGCUVPLVTHHXMT-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)