cas: 6625-74-7 — see every product listed under this CAS number, including other names
N–Pivaloylaniline (CAS 6625-74-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g, 500mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC41307-1 |
| cas | 6625-74-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 606.40 Pln | |
| GLPBio | 10g | 1954.38 Pln | |
| GLPBio | 5g | 1275.71 Pln | |
| GLPBio | 500mg | 512.79 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2,2-dimethyl-N-phenylpropanamide (CAS 6625-74-7) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: 2,2-dimethyl-N-phenylpropanamide. InChIKey: LWJNWXYSLBGWDU-UHFFFAOYSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | 2,2-dimethyl-N-phenylpropanamide |
| InChIKey | LWJNWXYSLBGWDU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC=CC=C1 |
Computed by PubChem (NCBI)