cas: 6625-74-7 — see every product listed under this CAS number, including other names
N-Phenylpivalamide, 99.98% (CAS 6625-74-7) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 50 g, 10 g, 5 g, 100 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W043105-1 g |
| cas | 6625-74-7 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 347.56 Pln | |
| MedChemExpress | 50 g | 2985.35 Pln | |
| MedChemExpress | 10 g | 1016.29 Pln | |
| MedChemExpress | 5 g | 677.28 Pln | |
| MedChemExpress | 100 g | 4698.98 Pln | |
| MedChemExpress | 25 g | 1907.94 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.98% |
2,2-dimethyl-N-phenylpropanamide (CAS 6625-74-7) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: 2,2-dimethyl-N-phenylpropanamide. InChIKey: LWJNWXYSLBGWDU-UHFFFAOYSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | 2,2-dimethyl-N-phenylpropanamide |
| InChIKey | LWJNWXYSLBGWDU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC=CC=C1 |
Computed by PubChem (NCBI)