CAS 6625-74-7 appears in our catalog under these names: tert-valeranilide, 95%, N-Pivaloylaniline, >95% (HPLC), Pivalanilide, N–Pivaloylaniline, N-Phenylpivalamide. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 500mg, 2,5g, 0,25g, 25g.
2,2-dimethyl-N-phenylpropanamide (CAS 6625-74-7) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: 2,2-dimethyl-N-phenylpropanamide. InChIKey: LWJNWXYSLBGWDU-UHFFFAOYSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | 2,2-dimethyl-N-phenylpropanamide |
| InChIKey | LWJNWXYSLBGWDU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC=CC=C1 |
Computed by PubChem (NCBI)