cas: 6625-74-7 — see every product listed under this CAS number, including other names
N-Phenylpivalamide, >98.0%(GC) (CAS 6625-74-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D6230-1G |
| cas | 6625-74-7 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 275.70 Pln | |
| TCI | 5g | 629.74 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2,2-dimethyl-N-phenylpropanamide (CAS 6625-74-7) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: 2,2-dimethyl-N-phenylpropanamide. InChIKey: LWJNWXYSLBGWDU-UHFFFAOYSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | 2,2-dimethyl-N-phenylpropanamide |
| InChIKey | LWJNWXYSLBGWDU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC=CC=C1 |
Computed by PubChem (NCBI)